C21H21N3O2 — CID 90439633
ethyl (E)-2-methyl-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]prop-2-enoate (PubChem CID 90439633) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-methyl-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90439633 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl (E)-2-methyl-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1ccc(-c2ncn(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-4-26-21(25)16(3)13-17-7-9-18(10-8-17)20-22-14-24(23-20)19-11-5-15(2)6-12-19/h5-14H,4H2,1-3H3/b16-13+ |
| InChIKey | ZJDGEDFMMAPSPS-DTQAZKPQSA-N |
| XLogP | 4.21 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|