C28H22F5N7O2 — CID 121414798
1-[2-(2,5-dimethylphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 121414798) has the molecular formula C28H22F5N7O2 and a molecular weight of 583.52 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[2-(2,5-dimethylphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 121414798 |
| Molecular Formula | C28H22F5N7O2 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 1-[2-(2,5-dimethylphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | Cc1ccc(C)c(-n2nccc2NC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C28H22F5N7O2/c1-17-3-4-18(2)23(15-17)40-24(13-14-35-40)37-26(41)36-20-7-5-19(6-8-20)25-34-16-39(38-25)21-9-11-22(12-10-21)42-28(32,33)27(29,30)31/h3-16H,1-2H3,(H2,36,37,41) |
| InChIKey | QOWHKCBUBLNXFZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|