C26H16Cl2F5N7O2 — CID 121429667
1-[2-(2,6-dichlorophenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 121429667) has the molecular formula C26H16Cl2F5N7O2 and a molecular weight of 624.36 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[2-(2,6-dichlorophenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 121429667 |
| Molecular Formula | C26H16Cl2F5N7O2 |
| Molecular Weight | 624.36 g/mol |
| Exact Mass | 623.07 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1)Nc1ccnn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H16Cl2F5N7O2/c27-19-2-1-3-20(28)22(19)40-21(12-13-35-40)37-24(41)36-16-6-4-15(5-7-16)23-34-14-39(38-23)17-8-10-18(11-9-17)42-26(32,33)25(29,30)31/h1-14H,(H2,36,37,41) |
| InChIKey | PTUWQGWZWZHLLR-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.36 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|