C32H31F5N6O4S — CID 136620024
[N-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]-N'-(2-propan-2-ylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate (PubChem CID 136620024) has the molecular formula C32H31F5N6O4S and a molecular weight of 690.70 g/mol. Its IUPAC name is [N-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]-N'-(2-propan-2-ylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate.
| Compound Name | [N-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]-N'-(2-propan-2-ylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 136620024 |
| Molecular Formula | C32H31F5N6O4S |
| Molecular Weight | 690.70 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | [N-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]-N'-(2-propan-2-ylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCS/C(=N\c1ccccc1C(C)C)NC(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H31F5N6O4S/c1-19(2)25-7-5-6-8-26(25)40-30(48-18-46-28(44)20(3)4)41-29(45)39-22-11-9-21(10-12-22)27-38-17-43(42-27)23-13-15-24(16-14-23)47-32(36,37)31(33,34)35/h5-17,19-20H,18H2,1-4H3,(H2,39,40,41,45) |
| InChIKey | GDZMENDMXOFKQB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.70 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|