C30H29F3N6O5S — CID 136629963
[N'-(4-methoxy-2-methylphenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate (PubChem CID 136629963) has the molecular formula C30H29F3N6O5S and a molecular weight of 642.66 g/mol. Its IUPAC name is [N'-(4-methoxy-2-methylphenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate.
| Compound Name | [N'-(4-methoxy-2-methylphenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 136629963 |
| Molecular Formula | C30H29F3N6O5S |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | [N'-(4-methoxy-2-methylphenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
| SMILES | COc1ccc(/N=C(/NC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)SCOC(=O)C(C)C)c(C)c1 |
| InChI | InChI=1S/C30H29F3N6O5S/c1-18(2)27(40)43-17-45-29(36-25-14-13-24(42-4)15-19(25)3)37-28(41)35-21-7-5-20(6-8-21)26-34-16-39(38-26)22-9-11-23(12-10-22)44-30(31,32)33/h5-16,18H,17H2,1-4H3,(H2,35,36,37,41) |
| InChIKey | NJAHLILDKSNDCF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|