C23H18F3N5O2S — CID 118675195
1-(4-methoxyphenyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea (PubChem CID 118675195) has the molecular formula C23H18F3N5O2S and a molecular weight of 485.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 118675195 |
| Molecular Formula | C23H18F3N5O2S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C23H18F3N5O2S/c1-32-19-10-6-17(7-11-19)29-22(34)28-16-4-2-15(3-5-16)21-27-14-31(30-21)18-8-12-20(13-9-18)33-23(24,25)26/h2-14H,1H3,(H2,28,29,34) |
| InChIKey | LLZXBERHWUYMJY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|