C23H19F3N6O2S — CID 118675107
1-(6-ethoxy-3-pyridinyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea (PubChem CID 118675107) has the molecular formula C23H19F3N6O2S and a molecular weight of 500.51 g/mol. Its IUPAC name is 1-(6-ethoxy-3-pyridinyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea.
| Compound Name | 1-(6-ethoxy-3-pyridinyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 118675107 |
| Molecular Formula | C23H19F3N6O2S |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-(6-ethoxy-3-pyridinyl)-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)cn1 |
| InChI | InChI=1S/C23H19F3N6O2S/c1-2-33-20-12-7-17(13-27-20)30-22(35)29-16-5-3-15(4-6-16)21-28-14-32(31-21)18-8-10-19(11-9-18)34-23(24,25)26/h3-14H,2H2,1H3,(H2,29,30,35) |
| InChIKey | JQLSZJRYZITYRX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|