C22H15F3N4O2S — CID 118675185
O-phenyl N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamothioate (PubChem CID 118675185) has the molecular formula C22H15F3N4O2S and a molecular weight of 456.45 g/mol. Its IUPAC name is O-phenyl N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamothioate.
| Compound Name | O-phenyl N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 118675185 |
| Molecular Formula | C22H15F3N4O2S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | O-phenyl N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamothioate |
| SMILES | FC(F)(F)Oc1ccc(-n2cnc(-c3ccc(NC(=S)Oc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C22H15F3N4O2S/c23-22(24,25)31-19-12-10-17(11-13-19)29-14-26-20(28-29)15-6-8-16(9-7-15)27-21(32)30-18-4-2-1-3-5-18/h1-14H,(H,27,32) |
| InChIKey | CQKPLOQCUYBSDU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|