C24H20F3N5O2S — CID 118590132
1-[(1R)-2-hydroxy-1-phenylethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea (PubChem CID 118590132) has the molecular formula C24H20F3N5O2S and a molecular weight of 499.52 g/mol. Its IUPAC name is 1-[(1R)-2-hydroxy-1-phenylethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea.
| Compound Name | 1-[(1R)-2-hydroxy-1-phenylethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 118590132 |
| Molecular Formula | C24H20F3N5O2S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 1-[(1R)-2-hydroxy-1-phenylethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
| SMILES | OC[C@H](NC(=S)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20F3N5O2S/c25-24(26,27)34-20-12-10-19(11-13-20)32-15-28-22(31-32)17-6-8-18(9-7-17)29-23(35)30-21(14-33)16-4-2-1-3-5-16/h1-13,15,21,33H,14H2,(H2,29,30,35)/t21-/m0/s1 |
| InChIKey | ISLNYRJBUGWXKI-NRFANRHFSA-N |
| XLogP | 4.85 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|