C24H20F3N5OS — CID 118590129
1-(2-hydroxy-1-phenylethyl)-3-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea (PubChem CID 118590129) has the molecular formula C24H20F3N5OS and a molecular weight of 483.52 g/mol. Its IUPAC name is 1-(2-hydroxy-1-phenylethyl)-3-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea.
| Compound Name | 1-(2-hydroxy-1-phenylethyl)-3-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 118590129 |
| Molecular Formula | C24H20F3N5OS |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 1-(2-hydroxy-1-phenylethyl)-3-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
| SMILES | OCC(NC(=S)Nc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20F3N5OS/c25-24(26,27)18-8-12-20(13-9-18)32-15-28-22(31-32)17-6-10-19(11-7-17)29-23(34)30-21(14-33)16-4-2-1-3-5-16/h1-13,15,21,33H,14H2,(H2,29,30,34) |
| InChIKey | LJPIJIVMOKJFLO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|