C18H19F3N2S — CID 100650624
1-[(1R)-1-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100650624) has the molecular formula C18H19F3N2S and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(1R)-1-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100650624 |
| Molecular Formula | C18H19F3N2S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(1R)-1-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC[C@@H](NC(=S)Nc1ccc(C(F)(F)F)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19F3N2S/c1-3-16(13-6-4-12(2)5-7-13)23-17(24)22-15-10-8-14(9-11-15)18(19,20)21/h4-11,16H,3H2,1-2H3,(H2,22,23,24)/t16-/m1/s1 |
| InChIKey | OALLFXYSRYLNAN-MRXNPFEDSA-N |
| XLogP | 5.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|