C17H18Cl2N2S — CID 27519172
1-(3,4-dichlorophenyl)-3-[(1S)-1-(4-methylphenyl)propyl]thiourea (PubChem CID 27519172) has the molecular formula C17H18Cl2N2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(1S)-1-(4-methylphenyl)propyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(1S)-1-(4-methylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 27519172 |
| Molecular Formula | C17H18Cl2N2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(1S)-1-(4-methylphenyl)propyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1ccc(Cl)c(Cl)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18Cl2N2S/c1-3-16(12-6-4-11(2)5-7-12)21-17(22)20-13-8-9-14(18)15(19)10-13/h4-10,16H,3H2,1-2H3,(H2,20,21,22)/t16-/m0/s1 |
| InChIKey | GJGHVRZACOEZSL-INIZCTEOSA-N |
| XLogP | 5.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|