C19H23ClN2O3S — CID 133216608
1-(3-chloro-4-methoxyphenyl)-3-[1-(3,4-dimethoxyphenyl)propyl]thiourea (PubChem CID 133216608) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[1-(3,4-dimethoxyphenyl)propyl]thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[1-(3,4-dimethoxyphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 133216608 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[1-(3,4-dimethoxyphenyl)propyl]thiourea |
| SMILES | CCC(NC(=S)Nc1ccc(OC)c(Cl)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-5-15(12-6-8-17(24-3)18(10-12)25-4)22-19(26)21-13-7-9-16(23-2)14(20)11-13/h6-11,15H,5H2,1-4H3,(H2,21,22,26) |
| InChIKey | LXJRDYGVXLDRQC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|