C17H17F3N4O — CID 144985108
ethane;N-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]hydroxylamine (PubChem CID 144985108) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is ethane;N-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]hydroxylamine.
| Compound Name | ethane;N-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]hydroxylamine |
|---|---|
| PubChem CID | 144985108 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | ethane;N-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]hydroxylamine |
| SMILES | CC.ONc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C15H11F3N4O.C2H6/c16-15(17,18)11-3-7-13(8-4-11)22-9-19-14(20-22)10-1-5-12(21-23)6-2-10;1-2/h1-9,21,23H;1-2H3 |
| InChIKey | JATONNFRIHUHLD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|