C15H10F4N4 — CID 155581293
2-fluoro-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]aniline (PubChem CID 155581293) has the molecular formula C15H10F4N4 and a molecular weight of 322.27 g/mol. Its IUPAC name is 2-fluoro-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-fluoro-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 155581293 |
| Molecular Formula | C15H10F4N4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-fluoro-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C15H10F4N4/c16-12-7-9(1-6-13(12)20)14-21-8-23(22-14)11-4-2-10(3-5-11)15(17,18)19/h1-8H,20H2 |
| InChIKey | WYCUTZKBSDNLCC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|