C15H11ClF4N4O — CID 178019259
2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]aniline;hydrochloride (PubChem CID 178019259) has the molecular formula C15H11ClF4N4O and a molecular weight of 374.73 g/mol. Its IUPAC name is 2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]aniline;hydrochloride.
| Compound Name | 2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]aniline;hydrochloride |
|---|---|
| PubChem CID | 178019259 |
| Molecular Formula | C15H11ClF4N4O |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C15H10F4N4O.ClH/c16-12-7-9(1-6-13(12)20)14-21-8-23(22-14)10-2-4-11(5-3-10)24-15(17,18)19;/h1-8H,20H2;1H |
| InChIKey | WCMDHJNSHOECQX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|