C19H15F3N4O — CID 90404304
4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-yn-1-amine (PubChem CID 90404304) has the molecular formula C19H15F3N4O and a molecular weight of 372.35 g/mol. Its IUPAC name is 4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-yn-1-amine.
| Compound Name | 4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-yn-1-amine |
|---|---|
| PubChem CID | 90404304 |
| Molecular Formula | C19H15F3N4O |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]but-3-yn-1-amine |
| SMILES | NCCC#Cc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H15F3N4O/c20-19(21,22)27-17-10-8-16(9-11-17)26-13-24-18(25-26)15-6-4-14(5-7-15)3-1-2-12-23/h4-11,13H,2,12,23H2 |
| InChIKey | NRINLWSSWCMYQC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|