C24H15F3N4O4 — CID 138680796
2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 138680796) has the molecular formula C24H15F3N4O4 and a molecular weight of 480.40 g/mol. Its IUPAC name is 2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138680796 |
| Molecular Formula | C24H15F3N4O4 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H15F3N4O4/c25-24(26,27)35-18-11-9-17(10-12-18)30-14-28-21(29-30)16-7-5-15(6-8-16)13-34-31-22(32)19-3-1-2-4-20(19)23(31)33/h1-12,14H,13H2 |
| InChIKey | ZDTGYWHORPERGU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|