C29H20F3N3O3 — CID 159392465
(3-phenylphenyl) 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate (PubChem CID 159392465) has the molecular formula C29H20F3N3O3 and a molecular weight of 515.49 g/mol. Its IUPAC name is (3-phenylphenyl) 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate.
| Compound Name | (3-phenylphenyl) 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate |
|---|---|
| PubChem CID | 159392465 |
| Molecular Formula | C29H20F3N3O3 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | (3-phenylphenyl) 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate |
| SMILES | O=C(Cc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H20F3N3O3/c30-29(31,32)38-25-15-13-24(14-16-25)35-19-33-28(34-35)22-11-9-20(10-12-22)17-27(36)37-26-8-4-7-23(18-26)21-5-2-1-3-6-21/h1-16,18-19H,17H2 |
| InChIKey | TZCUPLNDRJTBOI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|