C21H15F8N3O3 — CID 159701220
3,3,4,4,4-pentafluorobutan-2-yl 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate (PubChem CID 159701220) has the molecular formula C21H15F8N3O3 and a molecular weight of 509.35 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutan-2-yl 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate.
| Compound Name | 3,3,4,4,4-pentafluorobutan-2-yl 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate |
|---|---|
| PubChem CID | 159701220 |
| Molecular Formula | C21H15F8N3O3 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutan-2-yl 2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]acetate |
| SMILES | CC(OC(=O)Cc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H15F8N3O3/c1-12(19(22,23)20(24,25)26)34-17(33)10-13-2-4-14(5-3-13)18-30-11-32(31-18)15-6-8-16(9-7-15)35-21(27,28)29/h2-9,11-12H,10H2,1H3 |
| InChIKey | MXQJMLLACQTITC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|