C17H11F3N6 — CID 150257665
3-[4-(2-azidoethenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 150257665) has the molecular formula C17H11F3N6 and a molecular weight of 356.31 g/mol. Its IUPAC name is 3-[4-(2-azidoethenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-[4-(2-azidoethenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 150257665 |
| Molecular Formula | C17H11F3N6 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-[4-(2-azidoethenyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | [N-]=[N+]=NC=Cc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H11F3N6/c18-17(19,20)14-5-7-15(8-6-14)26-11-22-16(24-26)13-3-1-12(2-4-13)9-10-23-25-21/h1-11H |
| InChIKey | GAWXTAZTLOSRFU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|