C18H9F7N6O — CID 86675814
4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,2,4-triazol-3-yl]benzoyl azide (PubChem CID 86675814) has the molecular formula C18H9F7N6O and a molecular weight of 458.30 g/mol. Its IUPAC name is 4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,2,4-triazol-3-yl]benzoyl azide.
| Compound Name | 4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,2,4-triazol-3-yl]benzoyl azide |
|---|---|
| PubChem CID | 86675814 |
| Molecular Formula | C18H9F7N6O |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 4-[1-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,2,4-triazol-3-yl]benzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1ccc(-c2ncn(-c3ccc(C(F)(F)C(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H9F7N6O/c19-16(20,17(21,22)18(23,24)25)12-5-7-13(8-6-12)31-9-27-14(29-31)10-1-3-11(4-2-10)15(32)28-30-26/h1-9H |
| InChIKey | MRJPUYLQYAFXPS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 96.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|