C17H12F5N3 — CID 86633385
3-(4-methylphenyl)-1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazole (PubChem CID 86633385) has the molecular formula C17H12F5N3 and a molecular weight of 353.29 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-(4-methylphenyl)-1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 86633385 |
| Molecular Formula | C17H12F5N3 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-(4-methylphenyl)-1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazole |
| SMILES | Cc1ccc(-c2ncn(-c3ccc(C(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H12F5N3/c1-11-2-4-12(5-3-11)15-23-10-25(24-15)14-8-6-13(7-9-14)16(18,19)17(20,21)22/h2-10H,1H3 |
| InChIKey | YRLPTXZGVYPJIF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|