C26H25F3N6S — CID 157465477
methanethioamide;2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline (PubChem CID 157465477) has the molecular formula C26H25F3N6S and a molecular weight of 510.59 g/mol. Its IUPAC name is methanethioamide;2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline.
| Compound Name | methanethioamide;2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 157465477 |
| Molecular Formula | C26H25F3N6S |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | methanethioamide;2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline |
| SMILES | CC(C)c1ccccc1N/N=C\c1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1.NC=S |
| InChI | InChI=1S/C25H22F3N5.CH3NS/c1-17(2)22-5-3-4-6-23(22)31-30-15-18-7-9-19(10-8-18)24-29-16-33(32-24)21-13-11-20(12-14-21)25(26,27)28;2-1-3/h3-17,31H,1-2H3;1H,(H2,2,3)/b30-15-; |
| InChIKey | BUKPZQRRHYAETE-QGCFYLBGSA-N |
| XLogP | 6.42 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|