C15H10F6N2 — CID 3511340
2-(trifluoromethyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]aniline (PubChem CID 3511340) has the molecular formula C15H10F6N2 and a molecular weight of 332.25 g/mol. Its IUPAC name is 2-(trifluoromethyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2-(trifluoromethyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 3511340 |
| Molecular Formula | C15H10F6N2 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-(trifluoromethyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
| SMILES | FC(F)(F)c1ccc(C=NNc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6N2/c16-14(17,18)11-7-5-10(6-8-11)9-22-23-13-4-2-1-3-12(13)15(19,20)21/h1-9,23H |
| InChIKey | RSRKMLAPULCNOT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|