C14H10ClF3N2O2 — CID 135819465
3-chloro-5-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzene-1,2-diol (PubChem CID 135819465) has the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. Its IUPAC name is 3-chloro-5-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzene-1,2-diol.
| Compound Name | 3-chloro-5-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135819465 |
| Molecular Formula | C14H10ClF3N2O2 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-chloro-5-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzene-1,2-diol |
| SMILES | Oc1cc(/C=N/Nc2ccccc2C(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C14H10ClF3N2O2/c15-10-5-8(6-12(21)13(10)22)7-19-20-11-4-2-1-3-9(11)14(16,17)18/h1-7,20-22H/b19-7+ |
| InChIKey | CMERUJZGVYDDIN-FBCYGCLPSA-N |
| XLogP | 4.22 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|