C15H11Br2F3N2 — CID 71145987
N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(trifluoromethyl)aniline (PubChem CID 71145987) has the molecular formula C15H11Br2F3N2 and a molecular weight of 436.07 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 71145987 |
| Molecular Formula | C15H11Br2F3N2 |
| Molecular Weight | 436.07 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(trifluoromethyl)aniline |
| SMILES | Cc1c(Br)cc(/C=N\Nc2ccccc2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C15H11Br2F3N2/c1-9-12(16)6-10(7-13(9)17)8-21-22-14-5-3-2-4-11(14)15(18,19)20/h2-8,22H,1H3/b21-8- |
| InChIKey | HXEXREQYAGOYKM-WNFQYIGGSA-N |
| XLogP | 5.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.07 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|