C17H15F3N4S — CID 9211579
N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(trifluoromethyl)aniline (PubChem CID 9211579) has the molecular formula C17H15F3N4S and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 9211579 |
| Molecular Formula | C17H15F3N4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(trifluoromethyl)aniline |
| SMILES | Cc1cc(/C=N\Nc2ccccc2C(F)(F)F)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C17H15F3N4S/c1-11-9-13(12(2)24(11)16-21-7-8-25-16)10-22-23-15-6-4-3-5-14(15)17(18,19)20/h3-10,23H,1-2H3/b22-10- |
| InChIKey | UHNKCERQXIGNCQ-YVNNLAQVSA-N |
| XLogP | 5.02 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|