C17H18N4S — CID 9211279
N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-4-methylaniline (PubChem CID 9211279) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-4-methylaniline.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 9211279 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-4-methylaniline |
| SMILES | Cc1ccc(N/N=C\c2cc(C)n(-c3nccs3)c2C)cc1 |
| InChI | InChI=1S/C17H18N4S/c1-12-4-6-16(7-5-12)20-19-11-15-10-13(2)21(14(15)3)17-18-8-9-22-17/h4-11,20H,1-3H3/b19-11- |
| InChIKey | YKPMNIMPABYHLA-ODLFYWEKSA-N |
| XLogP | 4.31 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|