C16H17N5OS2 — CID 9231809
N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 9231809) has the molecular formula C16H17N5OS2 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 9231809 |
| Molecular Formula | C16H17N5OS2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)N/N=C\c2cc(C)n(-c3nccs3)c2C)cs1 |
| InChI | InChI=1S/C16H17N5OS2/c1-10-6-13(11(2)21(10)16-17-4-5-23-16)8-18-20-15(22)7-14-9-24-12(3)19-14/h4-6,8-9H,7H2,1-3H3,(H,20,22)/b18-8- |
| InChIKey | YGMHCWCSVDPOQH-LSCVHKIXSA-N |
| XLogP | 3.01 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|