C13H12BrN3O2S — CID 4531211
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 4531211) has the molecular formula C13H12BrN3O2S and a molecular weight of 354.23 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 4531211 |
| Molecular Formula | C13H12BrN3O2S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)NN=Cc2cc(Br)ccc2O)cs1 |
| InChI | InChI=1S/C13H12BrN3O2S/c1-8-16-11(7-20-8)5-13(19)17-15-6-9-4-10(14)2-3-12(9)18/h2-4,6-7,18H,5H2,1H3,(H,17,19) |
| InChIKey | ANWAZZIKMFNRAQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|