C15H16BrN3O3S — CID 9463664
N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 9463664) has the molecular formula C15H16BrN3O3S and a molecular weight of 398.28 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 9463664 |
| Molecular Formula | C15H16BrN3O3S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | COc1cc(Br)c(/C=N\NC(=O)Cc2csc(C)n2)cc1OC |
| InChI | InChI=1S/C15H16BrN3O3S/c1-9-18-11(8-23-9)5-15(20)19-17-7-10-4-13(21-2)14(22-3)6-12(10)16/h4,6-8H,5H2,1-3H3,(H,19,20)/b17-7- |
| InChIKey | HNGADTLZJPVIAY-IDUWFGFVSA-N |
| XLogP | 2.92 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|