C15H14ClF2N3O3S — CID 9463801
N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 9463801) has the molecular formula C15H14ClF2N3O3S and a molecular weight of 389.81 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 9463801 |
| Molecular Formula | C15H14ClF2N3O3S |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | N-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2csc(C)n2)cc(Cl)c1OC(F)F |
| InChI | InChI=1S/C15H14ClF2N3O3S/c1-8-20-10(7-25-8)5-13(22)21-19-6-9-3-11(16)14(24-15(17)18)12(4-9)23-2/h3-4,6-7,15H,5H2,1-2H3,(H,21,22)/b19-6- |
| InChIKey | QOXGVXNXNULXGV-SWNXQHNESA-N |
| XLogP | 3.41 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|