C13H11Cl2N3OS — CID 5106080
N-[(2,6-dichlorophenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 5106080) has the molecular formula C13H11Cl2N3OS and a molecular weight of 328.22 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 5106080 |
| Molecular Formula | C13H11Cl2N3OS |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)NN=Cc2c(Cl)cccc2Cl)cs1 |
| InChI | InChI=1S/C13H11Cl2N3OS/c1-8-17-9(7-20-8)5-13(19)18-16-6-10-11(14)3-2-4-12(10)15/h2-4,6-7H,5H2,1H3,(H,18,19) |
| InChIKey | GBEUOKPMTIDCDL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|