C19H20ClN5OS — CID 9463792
N-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 9463792) has the molecular formula C19H20ClN5OS and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 9463792 |
| Molecular Formula | C19H20ClN5OS |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1ccc(C)c(-n2nc(C)c(/C=N\NC(=O)Cc3csc(C)n3)c2Cl)c1 |
| InChI | InChI=1S/C19H20ClN5OS/c1-11-5-6-12(2)17(7-11)25-19(20)16(13(3)24-25)9-21-23-18(26)8-15-10-27-14(4)22-15/h5-7,9-10H,8H2,1-4H3,(H,23,26)/b21-9- |
| InChIKey | VBSXFCPFWRQHNI-NKVSQWTQSA-N |
| XLogP | 3.91 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|