C18H24ClN5OS — CID 9175692
1-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 9175692) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is 1-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9175692 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[(Z)-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@H](C)NC(=S)N/N=C\c1c(C)nn(-c2cc(C)ccc2C)c1Cl |
| InChI | InChI=1S/C18H24ClN5OS/c1-11-6-7-12(2)16(8-11)24-17(19)15(14(4)23-24)9-20-22-18(26)21-13(3)10-25-5/h6-9,13H,10H2,1-5H3,(H2,21,22,26)/b20-9-/t13-/m0/s1 |
| InChIKey | ZOGIGIKGBWBBMQ-CCSWUNFSSA-N |
| XLogP | 3.28 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|