C14H24ClN5OS — CID 9175819
1-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9175819) has the molecular formula C14H24ClN5OS and a molecular weight of 345.90 g/mol. Its IUPAC name is 1-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9175819 |
| Molecular Formula | C14H24ClN5OS |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | CCCCn1nc(C)c(/C=N\NC(=S)N[C@H](C)COC)c1Cl |
| InChI | InChI=1S/C14H24ClN5OS/c1-5-6-7-20-13(15)12(11(3)19-20)8-16-18-14(22)17-10(2)9-21-4/h8,10H,5-7,9H2,1-4H3,(H2,17,18,22)/b16-8-/t10-/m1/s1 |
| InChIKey | MQMYVMBJSBCOEG-NUEDXCKTSA-N |
| XLogP | 2.48 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|