C11H15ClN6S2 — CID 9295720
4-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione (PubChem CID 9295720) has the molecular formula C11H15ClN6S2 and a molecular weight of 330.87 g/mol. Its IUPAC name is 4-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 9295720 |
| Molecular Formula | C11H15ClN6S2 |
| Molecular Weight | 330.87 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
| SMILES | CCCCn1nc(C)c(/C=N\n2c(=S)[nH][nH]c2=S)c1Cl |
| InChI | InChI=1S/C11H15ClN6S2/c1-3-4-5-17-9(12)8(7(2)16-17)6-13-18-10(19)14-15-11(18)20/h6H,3-5H2,1-2H3,(H,14,19)(H,15,20)/b13-6+ |
| InChIKey | SMWDLXQPMFPMBB-AWNIVKPZSA-N |
| XLogP | 3.44 |
| TPSA | 66.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|