C15H18ClN5O2 — CID 9077428
N-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-nitroaniline (PubChem CID 9077428) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is N-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-nitroaniline.
| Compound Name | N-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-nitroaniline |
|---|---|
| PubChem CID | 9077428 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[(Z)-(1-butyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-3-nitroaniline |
| SMILES | CCCCn1nc(C)c(/C=N\Nc2cccc([N+](=O)[O-])c2)c1Cl |
| InChI | InChI=1S/C15H18ClN5O2/c1-3-4-8-20-15(16)14(11(2)19-20)10-17-18-12-6-5-7-13(9-12)21(22)23/h5-7,9-10,18H,3-4,8H2,1-2H3/b17-10- |
| InChIKey | NWBYGXNGRKDGCX-YVLHZVERSA-N |
| XLogP | 4.00 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|