C14H17N5O2S — CID 9077230
N,N-diethyl-5-[(Z)-[(3-nitrophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine (PubChem CID 9077230) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is N,N-diethyl-5-[(Z)-[(3-nitrophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[(Z)-[(3-nitrophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 9077230 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N,N-diethyl-5-[(Z)-[(3-nitrophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(/C=N\Nc2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C14H17N5O2S/c1-3-18(4-2)14-15-9-13(22-14)10-16-17-11-6-5-7-12(8-11)19(20)21/h5-10,17H,3-4H2,1-2H3/b16-10- |
| InChIKey | KVTCZJGOYYLJJM-YBEGLDIGSA-N |
| XLogP | 3.34 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|