C10H17N3O — CID 83290541
(NE)-N-[(1-butyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine (PubChem CID 83290541) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (NE)-N-[(1-butyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1-butyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 83290541 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (NE)-N-[(1-butyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine |
| SMILES | CCCCn1nc(C)c(/C=N/O)c1C |
| InChI | InChI=1S/C10H17N3O/c1-4-5-6-13-9(3)10(7-11-14)8(2)12-13/h7,14H,4-6H2,1-3H3/b11-7+ |
| InChIKey | PHKQQYXZBVDKMK-YRNVUSSQSA-N |
| XLogP | 2.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|