C9H14N2O — CID 6486756
3,5-dimethyl-1-propylpyrazole-4-carbaldehyde (PubChem CID 6486756) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3,5-dimethyl-1-propylpyrazole-4-carbaldehyde.
| Compound Name | 3,5-dimethyl-1-propylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 6486756 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3,5-dimethyl-1-propylpyrazole-4-carbaldehyde |
| SMILES | CCCn1nc(C)c(C=O)c1C |
| InChI | InChI=1S/C9H14N2O/c1-4-5-11-8(3)9(6-12)7(2)10-11/h6H,4-5H2,1-3H3 |
| InChIKey | YPNOCSHNEXPNTH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|