About 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid
3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 79619821) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid |
| PubChem CID | 79619821 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid |
| SMILES | Cc1nn(CC(C)(C)C(=O)O)c(C)c1C=O |
| InChI | InChI=1S/C11H16N2O3/c1-7-9(5-14)8(2)13(12-7)6-11(3,4)10(15)16/h5H,6H2,1-4H3,(H,15,16) |
| InChIKey | KYWLIBOUBSLUEC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid (CID 79619821) is 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid is Cc1nn(CC(C)(C)C(=O)O)c(C)c1C=O.
What is the InChIKey of 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid?
The InChIKey is KYWLIBOUBSLUEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-7-9(5-14)8(2)13(12-7)6-11(3,4)10(15)16/h5H,6H2,1-4H3,(H,15,16).
What are the key properties of 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid?
3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid has a molecular weight of 224.26 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79619821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).