C11H16N2O3 — CID 79619821
3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 79619821) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79619821 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-(4-formyl-3,5-dimethylpyrazol-1-yl)-2,2-dimethylpropanoic acid |
| SMILES | Cc1nn(CC(C)(C)C(=O)O)c(C)c1C=O |
| InChI | InChI=1S/C11H16N2O3/c1-7-9(5-14)8(2)13(12-7)6-11(3,4)10(15)16/h5H,6H2,1-4H3,(H,15,16) |
| InChIKey | KYWLIBOUBSLUEC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|