C12H20N2O3 — CID 103181656
1-[2-(3-methoxypropoxy)ethyl]-3,5-dimethylpyrazole-4-carbaldehyde (PubChem CID 103181656) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethyl]-3,5-dimethylpyrazole-4-carbaldehyde.
| Compound Name | 1-[2-(3-methoxypropoxy)ethyl]-3,5-dimethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 103181656 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethyl]-3,5-dimethylpyrazole-4-carbaldehyde |
| SMILES | COCCCOCCn1nc(C)c(C=O)c1C |
| InChI | InChI=1S/C12H20N2O3/c1-10-12(9-15)11(2)14(13-10)5-8-17-7-4-6-16-3/h9H,4-8H2,1-3H3 |
| InChIKey | QXHAKRTUEQSWJB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|