C10H17ClN2O3S — CID 104648864
1-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (PubChem CID 104648864) has the molecular formula C10H17ClN2O3S and a molecular weight of 280.78 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonyl chloride.
| Compound Name | 1-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 104648864 |
| Molecular Formula | C10H17ClN2O3S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
| SMILES | COCCCCn1nc(C)c(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C10H17ClN2O3S/c1-8-10(17(11,14)15)9(2)13(12-8)6-4-5-7-16-3/h4-7H2,1-3H3 |
| InChIKey | ZMGYCNHRZICVCW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|