C12H21IN2O3 — CID 104568877
4-iodo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,5-dimethylpyrazole (PubChem CID 104568877) has the molecular formula C12H21IN2O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is 4-iodo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,5-dimethylpyrazole.
| Compound Name | 4-iodo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 104568877 |
| Molecular Formula | C12H21IN2O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-iodo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,5-dimethylpyrazole |
| SMILES | COCCOCCOCCn1nc(C)c(I)c1C |
| InChI | InChI=1S/C12H21IN2O3/c1-10-12(13)11(2)15(14-10)4-5-17-8-9-18-7-6-16-3/h4-9H2,1-3H3 |
| InChIKey | NDYYDDUTCDWCPN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|