C13H19F3N2O3 — CID 103412797
2,2,2-trifluoro-1-[1-[3-(2-methoxyethoxy)propyl]-3,5-dimethylpyrazol-4-yl]ethanone (PubChem CID 103412797) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[3-(2-methoxyethoxy)propyl]-3,5-dimethylpyrazol-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-[3-(2-methoxyethoxy)propyl]-3,5-dimethylpyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 103412797 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[3-(2-methoxyethoxy)propyl]-3,5-dimethylpyrazol-4-yl]ethanone |
| SMILES | COCCOCCCn1nc(C)c(C(=O)C(F)(F)F)c1C |
| InChI | InChI=1S/C13H19F3N2O3/c1-9-11(12(19)13(14,15)16)10(2)18(17-9)5-4-6-21-8-7-20-3/h4-8H2,1-3H3 |
| InChIKey | LNDRFUMYCOFOGD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|