C7H11IN2 — CID 51063680
1-ethyl-4-iodo-3,5-dimethylpyrazole (PubChem CID 51063680) has the molecular formula C7H11IN2 and a molecular weight of 250.08 g/mol. Its IUPAC name is 1-ethyl-4-iodo-3,5-dimethylpyrazole.
| Compound Name | 1-ethyl-4-iodo-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 51063680 |
| Molecular Formula | C7H11IN2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-ethyl-4-iodo-3,5-dimethylpyrazole |
| SMILES | CCn1nc(C)c(I)c1C |
| InChI | InChI=1S/C7H11IN2/c1-4-10-6(3)7(8)5(2)9-10/h4H2,1-3H3 |
| InChIKey | LCEVIOMNOSQCQS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|