C12H11F2IN2 — CID 105411276
1-[(3,5-difluorophenyl)methyl]-4-iodo-3,5-dimethylpyrazole (PubChem CID 105411276) has the molecular formula C12H11F2IN2 and a molecular weight of 348.13 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-4-iodo-3,5-dimethylpyrazole.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-4-iodo-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 105411276 |
| Molecular Formula | C12H11F2IN2 |
| Molecular Weight | 348.13 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-4-iodo-3,5-dimethylpyrazole |
| SMILES | Cc1nn(Cc2cc(F)cc(F)c2)c(C)c1I |
| InChI | InChI=1S/C12H11F2IN2/c1-7-12(15)8(2)17(16-7)6-9-3-10(13)5-11(14)4-9/h3-5H,6H2,1-2H3 |
| InChIKey | DQKUUOIIYYZVCT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|