About 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole
1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole (PubChem CID 79709594) has the molecular formula C15H17BrClFN2
and a molecular weight of 359.67 g/mol. Its IUPAC name is 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole |
| PubChem CID | 79709594 |
| Molecular Formula | C15H17BrClFN2 |
| Molecular Weight | 359.67 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole |
| SMILES | CCC(Cl)c1c(C)nn(Cc2cc(F)cc(Br)c2)c1C |
| InChI | InChI=1S/C15H17BrClFN2/c1-4-14(17)15-9(2)19-20(10(15)3)8-11-5-12(16)7-13(18)6-11/h5-7,14H,4,8H2,1-3H3 |
| InChIKey | UOOXPRCYOXSRNS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.67 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole?
The IUPAC name of 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole (CID 79709594) is 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole.
What is the SMILES notation for 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole?
The canonical SMILES for 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole is CCC(Cl)c1c(C)nn(Cc2cc(F)cc(Br)c2)c1C.
What is the InChIKey of 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole?
The InChIKey is UOOXPRCYOXSRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrClFN2/c1-4-14(17)15-9(2)19-20(10(15)3)8-11-5-12(16)7-13(18)6-11/h5-7,14H,4,8H2,1-3H3.
What are the key properties of 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole?
1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole has a molecular weight of 359.67 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-bromo-5-fluorophenyl)methyl]-4-(1-chloropropyl)-3,5-dimethylpyrazole is sourced from PubChem (CID 79709594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).